C17H28N3OS+ — CID 9231849
1-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1-[(1R)-1-phenylethyl]thiourea (PubChem CID 9231849) has the molecular formula C17H28N3OS+ and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 9231849 |
| Molecular Formula | C17H28N3OS+ |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-methyl-3-(3-morpholin-4-ium-4-ylpropyl)-1-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@H](c1ccccc1)N(C)C(=S)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H27N3OS/c1-15(16-7-4-3-5-8-16)19(2)17(22)18-9-6-10-20-11-13-21-14-12-20/h3-5,7-8,15H,6,9-14H2,1-2H3,(H,18,22)/p+1/t15-/m1/s1 |
| InChIKey | ZXJYUPKDMFUHBX-OAHLLOKOSA-O |
| XLogP | 0.86 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|