C18H26N5O2+ — CID 7443262
N-(3-morpholin-4-ium-4-ylpropyl)-1-[(1S)-1-phenylethyl]triazole-4-carboxamide (PubChem CID 7443262) has the molecular formula C18H26N5O2+ and a molecular weight of 344.44 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-1-[(1S)-1-phenylethyl]triazole-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-1-[(1S)-1-phenylethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 7443262 |
| Molecular Formula | C18H26N5O2+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-1-[(1S)-1-phenylethyl]triazole-4-carboxamide |
| SMILES | C[C@@H](c1ccccc1)n1cc(C(=O)NCCC[NH+]2CCOCC2)nn1 |
| InChI | InChI=1S/C18H25N5O2/c1-15(16-6-3-2-4-7-16)23-14-17(20-21-23)18(24)19-8-5-9-22-10-12-25-13-11-22/h2-4,6-7,14-15H,5,8-13H2,1H3,(H,19,24)/p+1/t15-/m0/s1 |
| InChIKey | NGJGYOPKGSEBTP-HNNXBMFYSA-O |
| XLogP | -0.08 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|