C19H28N5O+ — CID 7443313
N-[2-(azepan-1-ium-1-yl)ethyl]-1-[(1R)-1-phenylethyl]triazole-4-carboxamide (PubChem CID 7443313) has the molecular formula C19H28N5O+ and a molecular weight of 342.47 g/mol. Its IUPAC name is N-[2-(azepan-1-ium-1-yl)ethyl]-1-[(1R)-1-phenylethyl]triazole-4-carboxamide.
| Compound Name | N-[2-(azepan-1-ium-1-yl)ethyl]-1-[(1R)-1-phenylethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 7443313 |
| Molecular Formula | C19H28N5O+ |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N-[2-(azepan-1-ium-1-yl)ethyl]-1-[(1R)-1-phenylethyl]triazole-4-carboxamide |
| SMILES | C[C@H](c1ccccc1)n1cc(C(=O)NCC[NH+]2CCCCCC2)nn1 |
| InChI | InChI=1S/C19H27N5O/c1-16(17-9-5-4-6-10-17)24-15-18(21-22-24)19(25)20-11-14-23-12-7-2-3-8-13-23/h4-6,9-10,15-16H,2-3,7-8,11-14H2,1H3,(H,20,25)/p+1/t16-/m1/s1 |
| InChIKey | STDFVMBAVSFHEX-MRXNPFEDSA-O |
| XLogP | 1.08 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |