C20H25ClN2O — CID 44662856
2,2-diphenyl-N-(2-pyrrolidin-1-ium-1-ylethyl)acetamide chloride (PubChem CID 44662856) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 2,2-diphenyl-N-(2-pyrrolidin-1-ium-1-ylethyl)acetamide chloride.
| Compound Name | 2,2-diphenyl-N-(2-pyrrolidin-1-ium-1-ylethyl)acetamide chloride |
|---|---|
| PubChem CID | 44662856 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2,2-diphenyl-N-(2-pyrrolidin-1-ium-1-ylethyl)acetamide chloride |
| SMILES | O=C(NCC[NH+]1CCCC1)C(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H24N2O.ClH/c23-20(21-13-16-22-14-7-8-15-22)19(17-9-3-1-4-10-17)18-11-5-2-6-12-18;/h1-6,9-12,19H,7-8,13-16H2,(H,21,23);1H |
| InChIKey | DURRPOQFSGOCHC-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |