C32H30N2O3 — CID 22301107
N-[2-[bis(2-phenylacetyl)amino]ethyl]-2,2-diphenylacetamide (PubChem CID 22301107) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is N-[2-[bis(2-phenylacetyl)amino]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[bis(2-phenylacetyl)amino]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 22301107 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-[2-[bis(2-phenylacetyl)amino]ethyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCCN(C(=O)Cc1ccccc1)C(=O)Cc1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O3/c35-29(23-25-13-5-1-6-14-25)34(30(36)24-26-15-7-2-8-16-26)22-21-33-32(37)31(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,31H,21-24H2,(H,33,37) |
| InChIKey | NXKNTBSMWACIHC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |