C42H44N2O3 — CID 21156390
N-[[3-[[bis(2-phenylacetyl)amino]methyl]-1-adamantyl]methyl]-2,2-diphenylacetamide (PubChem CID 21156390) has the molecular formula C42H44N2O3 and a molecular weight of 624.83 g/mol. Its IUPAC name is N-[[3-[[bis(2-phenylacetyl)amino]methyl]-1-adamantyl]methyl]-2,2-diphenylacetamide.
| Compound Name | N-[[3-[[bis(2-phenylacetyl)amino]methyl]-1-adamantyl]methyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 21156390 |
| Molecular Formula | C42H44N2O3 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | N-[[3-[[bis(2-phenylacetyl)amino]methyl]-1-adamantyl]methyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCC12CC3CC(C1)CC(CN(C(=O)Cc1ccccc1)C(=O)Cc1ccccc1)(C3)C2)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H44N2O3/c45-37(22-31-13-5-1-6-14-31)44(38(46)23-32-15-7-2-8-16-32)30-42-26-33-21-34(27-42)25-41(24-33,28-42)29-43-40(47)39(35-17-9-3-10-18-35)36-19-11-4-12-20-36/h1-20,33-34,39H,21-30H2,(H,43,47) |
| InChIKey | XSQGHYBPMFAKCP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |