About N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide
N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide (PubChem CID 23766189) has the molecular formula C26H31NO
and a molecular weight of 373.54 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide |
| PubChem CID | 23766189 |
| Molecular Formula | C26H31NO |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide |
| SMILES | O=C(NCCC12CC3CC(CC(C3)C1)C2)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31NO/c28-25(24(22-7-3-1-4-8-22)23-9-5-2-6-10-23)27-12-11-26-16-19-13-20(17-26)15-21(14-19)18-26/h1-10,19-21,24H,11-18H2,(H,27,28) |
| InChIKey | XVABSRFBVNLXDC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide?
The IUPAC name of N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide (CID 23766189) is N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide is O=C(NCCC12CC3CC(CC(C3)C1)C2)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide?
The InChIKey is XVABSRFBVNLXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO/c28-25(24(22-7-3-1-4-8-22)23-9-5-2-6-10-23)27-12-11-26-16-19-13-20(17-26)15-21(14-19)18-26/h1-10,19-21,24H,11-18H2,(H,27,28).
What are the key properties of N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide?
N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide has a molecular weight of 373.54 g/mol, XLogP of 5.54, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-adamantyl)ethyl]-2,2-diphenylacetamide is sourced from PubChem (CID 23766189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).