C40H53N3O2 — CID 11767229
N-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methyl]-6-(3,3,3-triphenylpropanoylamino)hexanamide (PubChem CID 11767229) has the molecular formula C40H53N3O2 and a molecular weight of 607.88 g/mol. Its IUPAC name is N-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methyl]-6-(3,3,3-triphenylpropanoylamino)hexanamide.
| Compound Name | N-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methyl]-6-(3,3,3-triphenylpropanoylamino)hexanamide |
|---|---|
| PubChem CID | 11767229 |
| Molecular Formula | C40H53N3O2 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 607.41 |
| IUPAC Name | N-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methyl]-6-(3,3,3-triphenylpropanoylamino)hexanamide |
| SMILES | O=C(CCCCCNC(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1)NC[C@H]1CCCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C40H53N3O2/c44-38(42-30-34-19-16-28-43(32-34)31-33-17-6-1-7-18-33)26-14-5-15-27-41-39(45)29-40(35-20-8-2-9-21-35,36-22-10-3-11-23-36)37-24-12-4-13-25-37/h2-4,8-13,20-25,33-34H,1,5-7,14-19,26-32H2,(H,41,45)(H,42,44)/t34-/m1/s1 |
| InChIKey | STUWFURQGSMWES-UUWRZZSWSA-N |
| XLogP | 7.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|