C42H54N4O3 — CID 11061341
(2S)-N-[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]-1-(3,3,3-triphenylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 11061341) has the molecular formula C42H54N4O3 and a molecular weight of 662.92 g/mol. Its IUPAC name is (2S)-N-[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]-1-(3,3,3-triphenylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]-1-(3,3,3-triphenylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11061341 |
| Molecular Formula | C42H54N4O3 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.42 |
| IUPAC Name | (2S)-N-[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]-1-(3,3,3-triphenylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(CCNC(=O)[C@@H]1CCCN1C(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1)NC[C@H]1CCCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C42H54N4O3/c47-39(44-30-34-17-13-27-45(32-34)31-33-15-5-1-6-16-33)25-26-43-41(49)38-24-14-28-46(38)40(48)29-42(35-18-7-2-8-19-35,36-20-9-3-10-21-36)37-22-11-4-12-23-37/h2-4,7-12,18-23,33-34,38H,1,5-6,13-17,24-32H2,(H,43,49)(H,44,47)/t34-,38+/m1/s1 |
| InChIKey | ZNXQAFLLESPBNZ-BYYXFNHRSA-N |
| XLogP | 6.32 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|