C40H52N4O3 — CID 11828362
N-[3-[[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]amino]-3-oxopropyl]-3,3,3-triphenylpropanamide (PubChem CID 11828362) has the molecular formula C40H52N4O3 and a molecular weight of 636.88 g/mol. Its IUPAC name is N-[3-[[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]amino]-3-oxopropyl]-3,3,3-triphenylpropanamide.
| Compound Name | N-[3-[[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]amino]-3-oxopropyl]-3,3,3-triphenylpropanamide |
|---|---|
| PubChem CID | 11828362 |
| Molecular Formula | C40H52N4O3 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | N-[3-[[3-[[(3R)-1-(cyclohexylmethyl)piperidin-3-yl]methylamino]-3-oxopropyl]amino]-3-oxopropyl]-3,3,3-triphenylpropanamide |
| SMILES | O=C(CCNC(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1)NCCC(=O)NC[C@H]1CCCN(CC2CCCCC2)C1 |
| InChI | InChI=1S/C40H52N4O3/c45-37(41-25-24-38(46)43-29-33-16-13-27-44(31-33)30-32-14-5-1-6-15-32)23-26-42-39(47)28-40(34-17-7-2-8-18-34,35-19-9-3-10-20-35)36-21-11-4-12-22-36/h2-4,7-12,17-22,32-33H,1,5-6,13-16,23-31H2,(H,41,45)(H,42,47)(H,43,46)/t33-/m1/s1 |
| InChIKey | POGDAPYUQHRUOU-MGBGTMOVSA-N |
| XLogP | 5.83 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|