C31H41NO4 — CID 162639590
N-benzyl-2,4-bis(3-hydroxy-1-adamantyl)-3-oxobutanamide (PubChem CID 162639590) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is N-benzyl-2,4-bis(3-hydroxy-1-adamantyl)-3-oxobutanamide.
| Compound Name | N-benzyl-2,4-bis(3-hydroxy-1-adamantyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 162639590 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | N-benzyl-2,4-bis(3-hydroxy-1-adamantyl)-3-oxobutanamide |
| SMILES | O=C(CC12CC3CC(CC(O)(C3)C1)C2)C(C(=O)NCc1ccccc1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C31H41NO4/c33-25(16-28-8-21-6-22(9-28)13-30(35,12-21)18-28)26(27(34)32-17-20-4-2-1-3-5-20)29-10-23-7-24(11-29)15-31(36,14-23)19-29/h1-5,21-24,26,35-36H,6-19H2,(H,32,34) |
| InChIKey | QYRTVIABHXIMLN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|