C26H29FN2O2 — CID 2882532
N-[1-(1-adamantyl)-2-(benzylamino)-2-oxoethyl]-4-fluorobenzamide (PubChem CID 2882532) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is N-[1-(1-adamantyl)-2-(benzylamino)-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[1-(1-adamantyl)-2-(benzylamino)-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 2882532 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[1-(1-adamantyl)-2-(benzylamino)-2-oxoethyl]-4-fluorobenzamide |
| SMILES | O=C(NC(C(=O)NCc1ccccc1)C12CC3CC(CC(C3)C1)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H29FN2O2/c27-22-8-6-21(7-9-22)24(30)29-23(25(31)28-16-17-4-2-1-3-5-17)26-13-18-10-19(14-26)12-20(11-18)15-26/h1-9,18-20,23H,10-16H2,(H,28,31)(H,29,30) |
| InChIKey | OPSFBQRNAIFHJT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |