C19H24Cl2NO2P — CID 4149625
N-benzyl-2-(3-dichlorophosphoryl-1-adamantyl)acetamide (PubChem CID 4149625) has the molecular formula C19H24Cl2NO2P and a molecular weight of 400.29 g/mol. Its IUPAC name is N-benzyl-2-(3-dichlorophosphoryl-1-adamantyl)acetamide.
| Compound Name | N-benzyl-2-(3-dichlorophosphoryl-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 4149625 |
| Molecular Formula | C19H24Cl2NO2P |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-benzyl-2-(3-dichlorophosphoryl-1-adamantyl)acetamide |
| SMILES | O=C(CC12CC3CC(C1)CC(P(=O)(Cl)Cl)(C3)C2)NCc1ccccc1 |
| InChI | InChI=1S/C19H24Cl2NO2P/c20-25(21,24)19-9-15-6-16(10-19)8-18(7-15,13-19)11-17(23)22-12-14-4-2-1-3-5-14/h1-5,15-16H,6-13H2,(H,22,23) |
| InChIKey | MOMFGVZVUISOOQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|