C23H34N2O4S — CID 24549163
N-[[4-(diethylsulfamoyl)phenyl]methyl]-2-(3-hydroxy-1-adamantyl)acetamide (PubChem CID 24549163) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is N-[[4-(diethylsulfamoyl)phenyl]methyl]-2-(3-hydroxy-1-adamantyl)acetamide.
| Compound Name | N-[[4-(diethylsulfamoyl)phenyl]methyl]-2-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 24549163 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[[4-(diethylsulfamoyl)phenyl]methyl]-2-(3-hydroxy-1-adamantyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H34N2O4S/c1-3-25(4-2)30(28,29)20-7-5-17(6-8-20)15-24-21(26)14-22-10-18-9-19(11-22)13-23(27,12-18)16-22/h5-8,18-19,27H,3-4,9-16H2,1-2H3,(H,24,26) |
| InChIKey | ZZJJJGVGCZFSDT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |