C13H22N2O2S — CID 28715770
N,N-diethyl-4-(ethylaminomethyl)benzenesulfonamide (PubChem CID 28715770) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N,N-diethyl-4-(ethylaminomethyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-4-(ethylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 28715770 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N,N-diethyl-4-(ethylaminomethyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C13H22N2O2S/c1-4-14-11-12-7-9-13(10-8-12)18(16,17)15(5-2)6-3/h7-10,14H,4-6,11H2,1-3H3 |
| InChIKey | VYXFQUKATFRNEG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |