C17H21ClN2O4S2 — CID 8815309
4-[[(4-chlorophenyl)sulfonylamino]methyl]-N,N-diethylbenzenesulfonamide (PubChem CID 8815309) has the molecular formula C17H21ClN2O4S2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8815309 |
| Molecular Formula | C17H21ClN2O4S2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H21ClN2O4S2/c1-3-20(4-2)26(23,24)17-9-5-14(6-10-17)13-19-25(21,22)16-11-7-15(18)8-12-16/h5-12,19H,3-4,13H2,1-2H3 |
| InChIKey | OGNAFQFLNKXEKM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |