C17H20Cl2N2O4S2 — CID 28536185
2,6-dichloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]benzenesulfonamide (PubChem CID 28536185) has the molecular formula C17H20Cl2N2O4S2 and a molecular weight of 451.40 g/mol. Its IUPAC name is 2,6-dichloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 28536185 |
| Molecular Formula | C17H20Cl2N2O4S2 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2,6-dichloro-N-[[4-(diethylsulfamoyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNS(=O)(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H20Cl2N2O4S2/c1-3-21(4-2)27(24,25)14-10-8-13(9-11-14)12-20-26(22,23)17-15(18)6-5-7-16(17)19/h5-11,20H,3-4,12H2,1-2H3 |
| InChIKey | NSXNXCYBJOQROH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |