C19H23Cl2N3O3S — CID 55473112
1-[(2,4-dichlorophenyl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea (PubChem CID 55473112) has the molecular formula C19H23Cl2N3O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55473112 |
| Molecular Formula | C19H23Cl2N3O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[4-(diethylsulfamoyl)phenyl]methyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2N3O3S/c1-3-24(4-2)28(26,27)17-9-5-14(6-10-17)12-22-19(25)23-13-15-7-8-16(20)11-18(15)21/h5-11H,3-4,12-13H2,1-2H3,(H2,22,23,25) |
| InChIKey | PNWWKWMJAMZVES-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |