C10H13Cl2NO2S — CID 3331535
2,6-dichloro-N,N-diethylbenzenesulfonamide (PubChem CID 3331535) has the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. Its IUPAC name is 2,6-dichloro-N,N-diethylbenzenesulfonamide.
| Compound Name | 2,6-dichloro-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3331535 |
| Molecular Formula | C10H13Cl2NO2S |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2,6-dichloro-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2S/c1-3-13(4-2)16(14,15)10-8(11)6-5-7-9(10)12/h5-7H,3-4H2,1-2H3 |
| InChIKey | LIKPHHKMGKKXCD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |