C13H12Cl3NO2S2 — CID 55870758
2,4,6-trichloro-N-ethyl-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 55870758) has the molecular formula C13H12Cl3NO2S2 and a molecular weight of 384.74 g/mol. Its IUPAC name is 2,4,6-trichloro-N-ethyl-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-ethyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55870758 |
| Molecular Formula | C13H12Cl3NO2S2 |
| Molecular Weight | 384.74 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | 2,4,6-trichloro-N-ethyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CCN(Cc1cccs1)S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl3NO2S2/c1-2-17(8-10-4-3-5-20-10)21(18,19)13-11(15)6-9(14)7-12(13)16/h3-7H,2,8H2,1H3 |
| InChIKey | PNCCKNSVQSWZNG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |