C10H14Cl2N2O2S — CID 119982528
N-(1-aminopropan-2-yl)-2,6-dichloro-N-methylbenzenesulfonamide (PubChem CID 119982528) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2,6-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-(1-aminopropan-2-yl)-2,6-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119982528 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2,6-dichloro-N-methylbenzenesulfonamide |
| SMILES | CC(CN)N(C)S(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-7(6-13)14(2)17(15,16)10-8(11)4-3-5-9(10)12/h3-5,7H,6,13H2,1-2H3 |
| InChIKey | PIGJQBVRQZIMHV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |