C11H19ClN2O2S2 — CID 120710579
N-(1-aminopropan-2-yl)-N-methyl-2-methylsulfanylbenzenesulfonamide;hydrochloride (PubChem CID 120710579) has the molecular formula C11H19ClN2O2S2 and a molecular weight of 310.87 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N-methyl-2-methylsulfanylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-N-methyl-2-methylsulfanylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120710579 |
| Molecular Formula | C11H19ClN2O2S2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N-methyl-2-methylsulfanylbenzenesulfonamide;hydrochloride |
| SMILES | CSc1ccccc1S(=O)(=O)N(C)C(C)CN.Cl |
| InChI | InChI=1S/C11H18N2O2S2.ClH/c1-9(8-12)13(2)17(14,15)11-7-5-4-6-10(11)16-3;/h4-7,9H,8,12H2,1-3H3;1H |
| InChIKey | BWPCOQZUJAHRSL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |