C11H18ClFN2O2S — CID 119982725
N-(1-aminopropan-2-yl)-1-(2-fluorophenyl)-N-methylmethanesulfonamide;hydrochloride (PubChem CID 119982725) has the molecular formula C11H18ClFN2O2S and a molecular weight of 296.79 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-1-(2-fluorophenyl)-N-methylmethanesulfonamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-1-(2-fluorophenyl)-N-methylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119982725 |
| Molecular Formula | C11H18ClFN2O2S |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(1-aminopropan-2-yl)-1-(2-fluorophenyl)-N-methylmethanesulfonamide;hydrochloride |
| SMILES | CC(CN)N(C)S(=O)(=O)Cc1ccccc1F.Cl |
| InChI | InChI=1S/C11H17FN2O2S.ClH/c1-9(7-13)14(2)17(15,16)8-10-5-3-4-6-11(10)12;/h3-6,9H,7-8,13H2,1-2H3;1H |
| InChIKey | QITIKIRAOASDHG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |