C11H19ClN2O2S — CID 119982693
N-(1-aminopropan-2-yl)-N-methyl-1-phenylmethanesulfonamide;hydrochloride (PubChem CID 119982693) has the molecular formula C11H19ClN2O2S and a molecular weight of 278.80 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N-methyl-1-phenylmethanesulfonamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-N-methyl-1-phenylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119982693 |
| Molecular Formula | C11H19ClN2O2S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N-methyl-1-phenylmethanesulfonamide;hydrochloride |
| SMILES | CC(CN)N(C)S(=O)(=O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C11H18N2O2S.ClH/c1-10(8-12)13(2)16(14,15)9-11-6-4-3-5-7-11;/h3-7,10H,8-9,12H2,1-2H3;1H |
| InChIKey | WSBGTIDPQMWKSY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |