C11H17NO3S — CID 94404339
N-[(2S)-2-hydroxypropyl]-N-methyl-1-phenylmethanesulfonamide (PubChem CID 94404339) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-[(2S)-2-hydroxypropyl]-N-methyl-1-phenylmethanesulfonamide.
| Compound Name | N-[(2S)-2-hydroxypropyl]-N-methyl-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 94404339 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[(2S)-2-hydroxypropyl]-N-methyl-1-phenylmethanesulfonamide |
| SMILES | C[C@H](O)CN(C)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H17NO3S/c1-10(13)8-12(2)16(14,15)9-11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | YGGZLHRBWSDLDW-JTQLQIEISA-N |
| XLogP | 0.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |