C13H21NO3S — CID 103924551
N-(5-hydroxypentyl)-N-methyl-1-phenylmethanesulfonamide (PubChem CID 103924551) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N-methyl-1-phenylmethanesulfonamide.
| Compound Name | N-(5-hydroxypentyl)-N-methyl-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 103924551 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(5-hydroxypentyl)-N-methyl-1-phenylmethanesulfonamide |
| SMILES | CN(CCCCCO)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H21NO3S/c1-14(10-6-3-7-11-15)18(16,17)12-13-8-4-2-5-9-13/h2,4-5,8-9,15H,3,6-7,10-12H2,1H3 |
| InChIKey | MXZFIESPUXUHTO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|