C24H36N2O5S — CID 24620340
N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(3-hydroxy-1-adamantyl)acetamide (PubChem CID 24620340) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(3-hydroxy-1-adamantyl)acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(3-hydroxy-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 24620340 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-ethoxyphenyl]-2-(3-hydroxy-1-adamantyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CC23CC4CC(CC(O)(C4)C2)C3)cc1S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C24H36N2O5S/c1-4-26(5-2)32(29,30)21-10-19(7-8-20(21)31-6-3)25-22(27)15-23-11-17-9-18(12-23)14-24(28,13-17)16-23/h7-8,10,17-18,28H,4-6,9,11-16H2,1-3H3,(H,25,27) |
| InChIKey | QPSIVUYFHHURPD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |