C20H26N2O3 — CID 72712581
[[2-(1-adamantyl)-2,2-dideuterioacetyl]amino] N-benzylcarbamate (PubChem CID 72712581) has the molecular formula C20H26N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is [[2-(1-adamantyl)-2,2-dideuterioacetyl]amino] N-benzylcarbamate.
| Compound Name | [[2-(1-adamantyl)-2,2-dideuterioacetyl]amino] N-benzylcarbamate |
|---|---|
| PubChem CID | 72712581 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [[2-(1-adamantyl)-2,2-dideuterioacetyl]amino] N-benzylcarbamate |
| SMILES | [2H]C([2H])(C(=O)NOC(=O)NCc1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26N2O3/c23-18(22-25-19(24)21-13-14-4-2-1-3-5-14)12-20-9-15-6-16(10-20)8-17(7-15)11-20/h1-5,15-17H,6-13H2,(H,21,24)(H,22,23)/i12D2 |
| InChIKey | JLJCEJYMLMYSLV-XUWBISKJSA-N |
| XLogP | 3.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|