C20H27N3O2 — CID 35512081
2-(1-adamantyl)-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide (PubChem CID 35512081) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 35512081 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide |
| SMILES | O=C(CNC(=O)CC12CC3CC(CC(C3)C1)C2)NCc1cccnc1 |
| InChI | InChI=1S/C20H27N3O2/c24-18(23-13-19(25)22-12-14-2-1-3-21-11-14)10-20-7-15-4-16(8-20)6-17(5-15)9-20/h1-3,11,15-17H,4-10,12-13H2,(H,22,25)(H,23,24) |
| InChIKey | AYSYANQCLARSJL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |