C18H25N3O — CID 108870288
1-(1-adamantylmethyl)-3-(pyridin-3-ylmethyl)urea (PubChem CID 108870288) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-(1-adamantylmethyl)-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 108870288 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-(1-adamantylmethyl)-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H25N3O/c22-17(20-11-13-2-1-3-19-10-13)21-12-18-7-14-4-15(8-18)6-16(5-14)9-18/h1-3,10,14-16H,4-9,11-12H2,(H2,20,21,22) |
| InChIKey | ZEVIJBMLMJIFGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |