C22H31N3O — CID 19572572
2-(1-adamantyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 19572572) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-adamantyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 19572572 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | 2-(1-adamantyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C22H31N3O/c26-21(14-22-11-18-8-19(12-22)10-20(9-18)13-22)25-6-4-24(5-7-25)16-17-2-1-3-23-15-17/h1-3,15,18-20H,4-14,16H2 |
| InChIKey | MSDRBQHMEDUPHZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |