C19H27N3O — CID 19572710
2-(2-bicyclo[2.2.1]heptanyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 19572710) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 19572710 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[4-(pyridin-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CC1CC2CCC1C2)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C19H27N3O/c23-19(12-18-11-15-3-4-17(18)10-15)22-8-6-21(7-9-22)14-16-2-1-5-20-13-16/h1-2,5,13,15,17-18H,3-4,6-12,14H2 |
| InChIKey | KULJTSDTCLLFNA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |