C18H26N4O — CID 125174143
[(2R)-6-azaspiro[2.5]octan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 125174143) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is [(2R)-6-azaspiro[2.5]octan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [(2R)-6-azaspiro[2.5]octan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 125174143 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [(2R)-6-azaspiro[2.5]octan-2-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1CC12CCNCC2)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C18H26N4O/c23-17(16-12-18(16)3-6-19-7-4-18)22-10-8-21(9-11-22)14-15-2-1-5-20-13-15/h1-2,5,13,16,19H,3-4,6-12,14H2/t16-/m0/s1 |
| InChIKey | HIDBEDIIXVRNGE-INIZCTEOSA-N |
| XLogP | 1.12 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |