C24H32N2O5 — CID 7360322
[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7360322) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7360322 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | COc1cccc(CNC(=O)COC(=O)CNC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H32N2O5/c1-30-20-4-2-3-16(8-20)13-25-22(28)15-31-23(29)14-26-21(27)12-24-9-17-5-18(10-24)7-19(6-17)11-24/h2-4,8,17-19H,5-7,9-15H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | OUZZACFTQINHSN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |