C24H33N3O4 — CID 7603650
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7603650) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7603650 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)CNC(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C24H33N3O4/c1-27(2)20-5-3-19(4-6-20)26-22(29)15-31-23(30)14-25-21(28)13-24-10-16-7-17(11-24)9-18(8-16)12-24/h3-6,16-18H,7-15H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | OLCHXTCPVOCUSR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|