C21H26ClN3O4 — CID 55309468
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 55309468) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 55309468 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)OCC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C21H26ClN3O4/c22-16-1-2-17(23-10-16)25-19(27)12-29-20(28)11-24-18(26)9-21-6-13-3-14(7-21)5-15(4-13)8-21/h1-2,10,13-15H,3-9,11-12H2,(H,24,26)(H,23,25,27) |
| InChIKey | GUGBUSXFBXYKEJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |