C22H26F2N2O4 — CID 7360297
[2-(2,5-difluoroanilino)-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7360297) has the molecular formula C22H26F2N2O4 and a molecular weight of 420.46 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7360297 |
| Molecular Formula | C22H26F2N2O4 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)OCC(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C22H26F2N2O4/c23-16-1-2-17(24)18(6-16)26-20(28)12-30-21(29)11-25-19(27)10-22-7-13-3-14(8-22)5-15(4-13)9-22/h1-2,6,13-15H,3-5,7-12H2,(H,25,27)(H,26,28) |
| InChIKey | OHVSBWMZEWOMJI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |