C21H22F2N2O4 — CID 2362655
[2-(2,5-difluoroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 2362655) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2362655 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)OCC(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C21H22F2N2O4/c1-21(2,3)14-6-4-13(5-7-14)20(28)24-11-19(27)29-12-18(26)25-17-10-15(22)8-9-16(17)23/h4-10H,11-12H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | DMHDHZGLIGSNLH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |