C18H21F2NOS — CID 8513122
2-(1-adamantylsulfanyl)-N-(2,5-difluorophenyl)acetamide (PubChem CID 8513122) has the molecular formula C18H21F2NOS and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-(1-adamantylsulfanyl)-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 8513122 |
| Molecular Formula | C18H21F2NOS |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-N-(2,5-difluorophenyl)acetamide |
| SMILES | O=C(CSC12CC3CC(CC(C3)C1)C2)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H21F2NOS/c19-14-1-2-15(20)16(6-14)21-17(22)10-23-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13H,3-5,7-10H2,(H,21,22) |
| InChIKey | PKSCACWCMJEYBI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |