C23H31NO4 — CID 7755309
2-(2-methylphenoxy)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7755309) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-(2-methylphenoxy)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | 2-(2-methylphenoxy)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7755309 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 2-(2-methylphenoxy)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | Cc1ccccc1OCCOC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO4/c1-16-4-2-3-5-20(16)27-6-7-28-22(26)15-24-21(25)14-23-11-17-8-18(12-23)10-19(9-17)13-23/h2-5,17-19H,6-15H2,1H3,(H,24,25) |
| InChIKey | OKTYNDUJHYAHBV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|