C22H28FNO4 — CID 55309705
(5-fluoro-2-methoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 55309705) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 55309705 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | COc1ccc(F)cc1COC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28FNO4/c1-27-19-3-2-18(23)7-17(19)13-28-21(26)12-24-20(25)11-22-8-14-4-15(9-22)6-16(5-14)10-22/h2-3,7,14-16H,4-6,8-13H2,1H3,(H,24,25) |
| InChIKey | HUFQJZPKZYJHEM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |