C22H28F2N2O2 — CID 9221124
2-(1-adamantyl)-N-[2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl]acetamide (PubChem CID 9221124) has the molecular formula C22H28F2N2O2 and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 9221124 |
| Molecular Formula | C22H28F2N2O2 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[[(1R)-1-(2,4-difluorophenyl)ethyl]amino]-2-oxoethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H28F2N2O2/c1-13(18-3-2-17(23)7-19(18)24)26-21(28)12-25-20(27)11-22-8-14-4-15(9-22)6-16(5-14)10-22/h2-3,7,13-16H,4-6,8-12H2,1H3,(H,25,27)(H,26,28)/t13-,14?,15?,16?,22?/m1/s1 |
| InChIKey | ZGHCGUMCIXXBKP-ZHHULCEESA-N |
| XLogP | 3.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |