C19H22BrF2NO — CID 8893926
(5S,7R)-3-bromo-N-[(1S)-1-(2,4-difluorophenyl)ethyl]adamantane-1-carboxamide (PubChem CID 8893926) has the molecular formula C19H22BrF2NO and a molecular weight of 398.29 g/mol. Its IUPAC name is (5S,7R)-3-bromo-N-[(1S)-1-(2,4-difluorophenyl)ethyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-bromo-N-[(1S)-1-(2,4-difluorophenyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 8893926 |
| Molecular Formula | C19H22BrF2NO |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (5S,7R)-3-bromo-N-[(1S)-1-(2,4-difluorophenyl)ethyl]adamantane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H22BrF2NO/c1-11(15-3-2-14(21)5-16(15)22)23-17(24)18-6-12-4-13(7-18)9-19(20,8-12)10-18/h2-3,5,11-13H,4,6-10H2,1H3,(H,23,24)/t11-,12-,13+,18?,19?/m0/s1 |
| InChIKey | DLLDGVJKTUQXEH-BGEGXTBBSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|