C21H26BrNO3 — CID 55454570
methyl 3-[(3-bromoadamantane-1-carbonyl)amino]-3-phenylpropanoate (PubChem CID 55454570) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is methyl 3-[(3-bromoadamantane-1-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | methyl 3-[(3-bromoadamantane-1-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 55454570 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | methyl 3-[(3-bromoadamantane-1-carbonyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)C12CC3CC(CC(Br)(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C21H26BrNO3/c1-26-18(24)8-17(16-5-3-2-4-6-16)23-19(25)20-9-14-7-15(10-20)12-21(22,11-14)13-20/h2-6,14-15,17H,7-13H2,1H3,(H,23,25) |
| InChIKey | UTOIOTBWBYDUHG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|