C21H28BrNO2 — CID 134028374
N-benzyl-3-bromo-N-(2-methoxyethyl)adamantane-1-carboxamide (PubChem CID 134028374) has the molecular formula C21H28BrNO2 and a molecular weight of 406.36 g/mol. Its IUPAC name is N-benzyl-3-bromo-N-(2-methoxyethyl)adamantane-1-carboxamide.
| Compound Name | N-benzyl-3-bromo-N-(2-methoxyethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 134028374 |
| Molecular Formula | C21H28BrNO2 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-benzyl-3-bromo-N-(2-methoxyethyl)adamantane-1-carboxamide |
| SMILES | COCCN(Cc1ccccc1)C(=O)C12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C21H28BrNO2/c1-25-8-7-23(14-16-5-3-2-4-6-16)19(24)20-10-17-9-18(11-20)13-21(22,12-17)15-20/h2-6,17-18H,7-15H2,1H3 |
| InChIKey | NXNUCNXDYXIUPB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|