C21H29BrN2O — CID 99848104
(5R,7R)-3-bromo-N-[(2S)-2-(dimethylamino)-2-phenylethyl]adamantane-1-carboxamide (PubChem CID 99848104) has the molecular formula C21H29BrN2O and a molecular weight of 405.38 g/mol. Its IUPAC name is (5R,7R)-3-bromo-N-[(2S)-2-(dimethylamino)-2-phenylethyl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-bromo-N-[(2S)-2-(dimethylamino)-2-phenylethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 99848104 |
| Molecular Formula | C21H29BrN2O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (5R,7R)-3-bromo-N-[(2S)-2-(dimethylamino)-2-phenylethyl]adamantane-1-carboxamide |
| SMILES | CN(C)[C@H](CNC(=O)C12C[C@H]3C[C@@H](CC(Br)(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C21H29BrN2O/c1-24(2)18(17-6-4-3-5-7-17)13-23-19(25)20-9-15-8-16(10-20)12-21(22,11-15)14-20/h3-7,15-16,18H,8-14H2,1-2H3,(H,23,25)/t15-,16-,18-,20?,21?/m1/s1 |
| InChIKey | YNBHFAGUCCELGH-FCHMRMGVSA-N |
| XLogP | 4.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|