C13H21BrN2O — CID 5120362
3-bromo-N',N'-dimethyladamantane-1-carbohydrazide (PubChem CID 5120362) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is 3-bromo-N',N'-dimethyladamantane-1-carbohydrazide.
| Compound Name | 3-bromo-N',N'-dimethyladamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 5120362 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-bromo-N',N'-dimethyladamantane-1-carbohydrazide |
| SMILES | CN(C)NC(=O)C12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C13H21BrN2O/c1-16(2)15-11(17)12-4-9-3-10(5-12)7-13(14,6-9)8-12/h9-10H,3-8H2,1-2H3,(H,15,17) |
| InChIKey | NICFOQRBNPNSFP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|