C21H30BrNO — CID 7732542
(5S,7R)-N-(1-adamantyl)-3-bromoadamantane-1-carboxamide (PubChem CID 7732542) has the molecular formula C21H30BrNO and a molecular weight of 392.38 g/mol. Its IUPAC name is (5S,7R)-N-(1-adamantyl)-3-bromoadamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(1-adamantyl)-3-bromoadamantane-1-carboxamide |
|---|---|
| PubChem CID | 7732542 |
| Molecular Formula | C21H30BrNO |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (5S,7R)-N-(1-adamantyl)-3-bromoadamantane-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C21H30BrNO/c22-20-7-16-4-17(8-20)6-19(5-16,12-20)18(24)23-21-9-13-1-14(10-21)3-15(2-13)11-21/h13-17H,1-12H2,(H,23,24)/t13?,14?,15?,16-,17+,19?,20?,21? |
| InChIKey | NJJYVDRZDPAREA-SDEIDPOFSA-N |
| XLogP | 4.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|