C23H35NO — CID 171577279
N-(3,5-dimethyl-1-adamantyl)adamantane-1-carboxamide (PubChem CID 171577279) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-adamantyl)adamantane-1-carboxamide.
| Compound Name | N-(3,5-dimethyl-1-adamantyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171577279 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | N-(3,5-dimethyl-1-adamantyl)adamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)C14CC5CC(CC(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C23H35NO/c1-20-6-18-7-21(2,12-20)14-23(11-18,13-20)24-19(25)22-8-15-3-16(9-22)5-17(4-15)10-22/h15-18H,3-14H2,1-2H3,(H,24,25) |
| InChIKey | SVKXJDMWWJOJCM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |