C14H22INO — CID 4606569
N-(3,5-dimethyl-1-adamantyl)-2-iodoacetamide (PubChem CID 4606569) has the molecular formula C14H22INO and a molecular weight of 347.24 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-adamantyl)-2-iodoacetamide.
| Compound Name | N-(3,5-dimethyl-1-adamantyl)-2-iodoacetamide |
|---|---|
| PubChem CID | 4606569 |
| Molecular Formula | C14H22INO |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-(3,5-dimethyl-1-adamantyl)-2-iodoacetamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)CI)(C3)C2 |
| InChI | InChI=1S/C14H22INO/c1-12-3-10-4-13(2,7-12)9-14(5-10,8-12)16-11(17)6-15/h10H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | CPXUWXCOYFNNBC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|